C14H20N3O3S+ — CID 6912298
(Z)-2-hydroxy-7-[(4-methylphenyl)sulfonylamino]hept-1-ene-1-diazonium (PubChem CID 6912298) has the molecular formula C14H20N3O3S+ and a molecular weight of 310.40 g/mol. Its IUPAC name is (Z)-2-hydroxy-7-[(4-methylphenyl)sulfonylamino]hept-1-ene-1-diazonium.
| Compound Name | (Z)-2-hydroxy-7-[(4-methylphenyl)sulfonylamino]hept-1-ene-1-diazonium |
|---|---|
| PubChem CID | 6912298 |
| Molecular Formula | C14H20N3O3S+ |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | (Z)-2-hydroxy-7-[(4-methylphenyl)sulfonylamino]hept-1-ene-1-diazonium |
| SMILES | Cc1ccc(S(=O)(=O)NCCCCC/C(O)=C/[N+]#N)cc1 |
| InChI | InChI=1S/C14H19N3O3S/c1-12-6-8-14(9-7-12)21(19,20)17-10-4-2-3-5-13(18)11-16-15/h6-9,11,17H,2-5,10H2,1H3/p+1/b13-11- |
| InChIKey | DFUCISWWAMEOST-QBFSEMIESA-O |
| XLogP | 3.09 |
| TPSA | 94.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|