C15H22ClNO5S — CID 99996993
3-chloro-N-[(3R)-3-hydroxy-3-(oxan-4-yl)propyl]-4-methoxybenzenesulfonamide (PubChem CID 99996993) has the molecular formula C15H22ClNO5S and a molecular weight of 363.86 g/mol. Its IUPAC name is 3-chloro-N-[(3R)-3-hydroxy-3-(oxan-4-yl)propyl]-4-methoxybenzenesulfonamide.
| Compound Name | 3-chloro-N-[(3R)-3-hydroxy-3-(oxan-4-yl)propyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 99996993 |
| Molecular Formula | C15H22ClNO5S |
| Molecular Weight | 363.86 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 3-chloro-N-[(3R)-3-hydroxy-3-(oxan-4-yl)propyl]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCC[C@@H](O)C2CCOCC2)cc1Cl |
| InChI | InChI=1S/C15H22ClNO5S/c1-21-15-3-2-12(10-13(15)16)23(19,20)17-7-4-14(18)11-5-8-22-9-6-11/h2-3,10-11,14,17-18H,4-9H2,1H3/t14-/m1/s1 |
| InChIKey | NXZCXRQUMQDTKV-CQSZACIVSA-N |
| XLogP | 1.80 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.86 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |