C17H23N3O4S — CID 86266682
N-[3-hydroxy-3-(oxan-4-yl)propyl]-4-pyrazol-1-ylbenzenesulfonamide (PubChem CID 86266682) has the molecular formula C17H23N3O4S and a molecular weight of 365.45 g/mol. Its IUPAC name is N-[3-hydroxy-3-(oxan-4-yl)propyl]-4-pyrazol-1-ylbenzenesulfonamide.
| Compound Name | N-[3-hydroxy-3-(oxan-4-yl)propyl]-4-pyrazol-1-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 86266682 |
| Molecular Formula | C17H23N3O4S |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | N-[3-hydroxy-3-(oxan-4-yl)propyl]-4-pyrazol-1-ylbenzenesulfonamide |
| SMILES | O=S(=O)(NCCC(O)C1CCOCC1)c1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C17H23N3O4S/c21-17(14-7-12-24-13-8-14)6-10-19-25(22,23)16-4-2-15(3-5-16)20-11-1-9-18-20/h1-5,9,11,14,17,19,21H,6-8,10,12-13H2 |
| InChIKey | QGNDGKORTQTQFI-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |