C18H20N4O2S2 — CID 100691082
N-[(2R)-2-(azetidin-1-yl)-2-thiophen-3-ylethyl]-4-pyrazol-1-ylbenzenesulfonamide (PubChem CID 100691082) has the molecular formula C18H20N4O2S2 and a molecular weight of 388.52 g/mol. Its IUPAC name is N-[(2R)-2-(azetidin-1-yl)-2-thiophen-3-ylethyl]-4-pyrazol-1-ylbenzenesulfonamide.
| Compound Name | N-[(2R)-2-(azetidin-1-yl)-2-thiophen-3-ylethyl]-4-pyrazol-1-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 100691082 |
| Molecular Formula | C18H20N4O2S2 |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | N-[(2R)-2-(azetidin-1-yl)-2-thiophen-3-ylethyl]-4-pyrazol-1-ylbenzenesulfonamide |
| SMILES | O=S(=O)(NC[C@@H](c1ccsc1)N1CCC1)c1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C18H20N4O2S2/c23-26(24,17-5-3-16(4-6-17)22-11-1-8-19-22)20-13-18(21-9-2-10-21)15-7-12-25-14-15/h1,3-8,11-12,14,18,20H,2,9-10,13H2/t18-/m0/s1 |
| InChIKey | LJTQNJUWIJUISZ-SFHVURJKSA-N |
| XLogP | 2.66 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |