C14H14F3NO3S2 — CID 99981469
N-[(3R)-3-hydroxy-3-thiophen-3-ylpropyl]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 99981469) has the molecular formula C14H14F3NO3S2 and a molecular weight of 365.40 g/mol. Its IUPAC name is N-[(3R)-3-hydroxy-3-thiophen-3-ylpropyl]-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[(3R)-3-hydroxy-3-thiophen-3-ylpropyl]-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 99981469 |
| Molecular Formula | C14H14F3NO3S2 |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | N-[(3R)-3-hydroxy-3-thiophen-3-ylpropyl]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCC[C@@H](O)c1ccsc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H14F3NO3S2/c15-14(16,17)11-2-1-3-12(8-11)23(20,21)18-6-4-13(19)10-5-7-22-9-10/h1-3,5,7-9,13,18-19H,4,6H2/t13-/m1/s1 |
| InChIKey | FNWRXKLORNKNII-CYBMUJFWSA-N |
| XLogP | 3.17 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |