C11H11N3O5S2 — CID 106436200
N-(2-hydroxy-2-thiophen-3-ylethyl)-6-nitropyridine-3-sulfonamide (PubChem CID 106436200) has the molecular formula C11H11N3O5S2 and a molecular weight of 329.36 g/mol. Its IUPAC name is N-(2-hydroxy-2-thiophen-3-ylethyl)-6-nitropyridine-3-sulfonamide.
| Compound Name | N-(2-hydroxy-2-thiophen-3-ylethyl)-6-nitropyridine-3-sulfonamide |
|---|---|
| PubChem CID | 106436200 |
| Molecular Formula | C11H11N3O5S2 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.01 |
| IUPAC Name | N-(2-hydroxy-2-thiophen-3-ylethyl)-6-nitropyridine-3-sulfonamide |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)NCC(O)c2ccsc2)cn1 |
| InChI | InChI=1S/C11H11N3O5S2/c15-10(8-3-4-20-7-8)6-13-21(18,19)9-1-2-11(12-5-9)14(16)17/h1-5,7,10,13,15H,6H2 |
| InChIKey | NIISIUACSDHLNZ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 122.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|