C10H17NO3S2 — CID 103916531
N-(2-hydroxy-2-thiophen-3-ylethyl)-2-methylpropane-1-sulfonamide (PubChem CID 103916531) has the molecular formula C10H17NO3S2 and a molecular weight of 263.38 g/mol. Its IUPAC name is N-(2-hydroxy-2-thiophen-3-ylethyl)-2-methylpropane-1-sulfonamide.
| Compound Name | N-(2-hydroxy-2-thiophen-3-ylethyl)-2-methylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 103916531 |
| Molecular Formula | C10H17NO3S2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | N-(2-hydroxy-2-thiophen-3-ylethyl)-2-methylpropane-1-sulfonamide |
| SMILES | CC(C)CS(=O)(=O)NCC(O)c1ccsc1 |
| InChI | InChI=1S/C10H17NO3S2/c1-8(2)7-16(13,14)11-5-10(12)9-3-4-15-6-9/h3-4,6,8,10-12H,5,7H2,1-2H3 |
| InChIKey | QPBDNNLFCOIMFF-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |