C10H12N2O3S2 — CID 114188652
N-(2-hydroxy-2-thiophen-3-ylethyl)-1H-pyrrole-3-sulfonamide (PubChem CID 114188652) has the molecular formula C10H12N2O3S2 and a molecular weight of 272.35 g/mol. Its IUPAC name is N-(2-hydroxy-2-thiophen-3-ylethyl)-1H-pyrrole-3-sulfonamide.
| Compound Name | N-(2-hydroxy-2-thiophen-3-ylethyl)-1H-pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 114188652 |
| Molecular Formula | C10H12N2O3S2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | N-(2-hydroxy-2-thiophen-3-ylethyl)-1H-pyrrole-3-sulfonamide |
| SMILES | O=S(=O)(NCC(O)c1ccsc1)c1cc[nH]c1 |
| InChI | InChI=1S/C10H12N2O3S2/c13-10(8-2-4-16-7-8)6-12-17(14,15)9-1-3-11-5-9/h1-5,7,10-13H,6H2 |
| InChIKey | ZGHKSOFHHGBLKG-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |