C22H27N3O5S — CID 163861602
N-[[4-(cyclohexylcarbamoylsulfamoyl)phenyl]-phenoxymethyl]acetamide (PubChem CID 163861602) has the molecular formula C22H27N3O5S and a molecular weight of 445.54 g/mol. Its IUPAC name is N-[[4-(cyclohexylcarbamoylsulfamoyl)phenyl]-phenoxymethyl]acetamide.
| Compound Name | N-[[4-(cyclohexylcarbamoylsulfamoyl)phenyl]-phenoxymethyl]acetamide |
|---|---|
| PubChem CID | 163861602 |
| Molecular Formula | C22H27N3O5S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | N-[[4-(cyclohexylcarbamoylsulfamoyl)phenyl]-phenoxymethyl]acetamide |
| SMILES | CC(=O)NC(Oc1ccccc1)c1ccc(S(=O)(=O)NC(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C22H27N3O5S/c1-16(26)23-21(30-19-10-6-3-7-11-19)17-12-14-20(15-13-17)31(28,29)25-22(27)24-18-8-4-2-5-9-18/h3,6-7,10-15,18,21H,2,4-5,8-9H2,1H3,(H,23,26)(H2,24,25,27) |
| InChIKey | PCZUTUVYABZNQH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|