C28H28N4O3S — CID 134111037
1-cyclohexyl-3-[4-(3,5-diphenylpyrazol-1-yl)phenyl]sulfonylurea (PubChem CID 134111037) has the molecular formula C28H28N4O3S and a molecular weight of 500.62 g/mol. Its IUPAC name is 1-cyclohexyl-3-[4-(3,5-diphenylpyrazol-1-yl)phenyl]sulfonylurea.
| Compound Name | 1-cyclohexyl-3-[4-(3,5-diphenylpyrazol-1-yl)phenyl]sulfonylurea |
|---|---|
| PubChem CID | 134111037 |
| Molecular Formula | C28H28N4O3S |
| Molecular Weight | 500.62 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | 1-cyclohexyl-3-[4-(3,5-diphenylpyrazol-1-yl)phenyl]sulfonylurea |
| SMILES | O=C(NC1CCCCC1)NS(=O)(=O)c1ccc(-n2nc(-c3ccccc3)cc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H28N4O3S/c33-28(29-23-14-8-3-9-15-23)31-36(34,35)25-18-16-24(17-19-25)32-27(22-12-6-2-7-13-22)20-26(30-32)21-10-4-1-5-11-21/h1-2,4-7,10-13,16-20,23H,3,8-9,14-15H2,(H2,29,31,33) |
| InChIKey | BVVCIBCKKALRFI-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.62 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |