C13H8Cl4N4O2 — CID 7987802
3,5,6-trichloro-N-[(Z)-1-(4-chloro-3-nitrophenyl)ethylideneamino]pyridin-2-amine (PubChem CID 7987802) has the molecular formula C13H8Cl4N4O2 and a molecular weight of 394.05 g/mol. Its IUPAC name is 3,5,6-trichloro-N-[(Z)-1-(4-chloro-3-nitrophenyl)ethylideneamino]pyridin-2-amine.
| Compound Name | 3,5,6-trichloro-N-[(Z)-1-(4-chloro-3-nitrophenyl)ethylideneamino]pyridin-2-amine |
|---|---|
| PubChem CID | 7987802 |
| Molecular Formula | C13H8Cl4N4O2 |
| Molecular Weight | 394.05 g/mol |
| Exact Mass | 391.94 |
| IUPAC Name | 3,5,6-trichloro-N-[(Z)-1-(4-chloro-3-nitrophenyl)ethylideneamino]pyridin-2-amine |
| SMILES | C/C(=N/Nc1nc(Cl)c(Cl)cc1Cl)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H8Cl4N4O2/c1-6(7-2-3-8(14)11(4-7)21(22)23)19-20-13-10(16)5-9(15)12(17)18-13/h2-5H,1H3,(H,18,20)/b19-6- |
| InChIKey | VMCODEHCRBCMHR-SWNXQHNESA-N |
| XLogP | 5.44 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.05 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|