C16H12Cl2N4S — CID 3422208
1-[1-(4-cyanophenyl)ethylideneamino]-3-(3,4-dichlorophenyl)thiourea (PubChem CID 3422208) has the molecular formula C16H12Cl2N4S and a molecular weight of 363.27 g/mol. Its IUPAC name is 1-[1-(4-cyanophenyl)ethylideneamino]-3-(3,4-dichlorophenyl)thiourea.
| Compound Name | 1-[1-(4-cyanophenyl)ethylideneamino]-3-(3,4-dichlorophenyl)thiourea |
|---|---|
| PubChem CID | 3422208 |
| Molecular Formula | C16H12Cl2N4S |
| Molecular Weight | 363.27 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | 1-[1-(4-cyanophenyl)ethylideneamino]-3-(3,4-dichlorophenyl)thiourea |
| SMILES | CC(=NNC(=S)Nc1ccc(Cl)c(Cl)c1)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C16H12Cl2N4S/c1-10(12-4-2-11(9-19)3-5-12)21-22-16(23)20-13-6-7-14(17)15(18)8-13/h2-8H,1H3,(H2,20,22,23) |
| InChIKey | SNTWKEHWISYCKW-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 60.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.27 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|