C17H14ClF3N2O2 — CID 108984887
N'-benzyl-N-[2-chloro-5-(trifluoromethyl)phenyl]-N'-methyloxamide (PubChem CID 108984887) has the molecular formula C17H14ClF3N2O2 and a molecular weight of 370.76 g/mol. Its IUPAC name is N'-benzyl-N-[2-chloro-5-(trifluoromethyl)phenyl]-N'-methyloxamide.
| Compound Name | N'-benzyl-N-[2-chloro-5-(trifluoromethyl)phenyl]-N'-methyloxamide |
|---|---|
| PubChem CID | 108984887 |
| Molecular Formula | C17H14ClF3N2O2 |
| Molecular Weight | 370.76 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | N'-benzyl-N-[2-chloro-5-(trifluoromethyl)phenyl]-N'-methyloxamide |
| SMILES | CN(Cc1ccccc1)C(=O)C(=O)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C17H14ClF3N2O2/c1-23(10-11-5-3-2-4-6-11)16(25)15(24)22-14-9-12(17(19,20)21)7-8-13(14)18/h2-9H,10H2,1H3,(H,22,24) |
| InChIKey | QMPGWOYGUXDLHB-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.76 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|