C23H28ClN3O3S — CID 4512219
N-[3-[[2-(4-tert-butylphenoxy)acetyl]carbamothioylamino]-4-chlorophenyl]butanamide (PubChem CID 4512219) has the molecular formula C23H28ClN3O3S and a molecular weight of 462.02 g/mol. Its IUPAC name is N-[3-[[2-(4-tert-butylphenoxy)acetyl]carbamothioylamino]-4-chlorophenyl]butanamide.
| Compound Name | N-[3-[[2-(4-tert-butylphenoxy)acetyl]carbamothioylamino]-4-chlorophenyl]butanamide |
|---|---|
| PubChem CID | 4512219 |
| Molecular Formula | C23H28ClN3O3S |
| Molecular Weight | 462.02 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | N-[3-[[2-(4-tert-butylphenoxy)acetyl]carbamothioylamino]-4-chlorophenyl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(Cl)c(NC(=S)NC(=O)COc2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C23H28ClN3O3S/c1-5-6-20(28)25-16-9-12-18(24)19(13-16)26-22(31)27-21(29)14-30-17-10-7-15(8-11-17)23(2,3)4/h7-13H,5-6,14H2,1-4H3,(H,25,28)(H2,26,27,29,31) |
| InChIKey | FUYGNYWPMATEEP-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.02 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|