C23H20N2O4S — CID 17127835
butyl 2-[(5-phenylfuran-2-carbonyl)amino]-1,3-benzothiazole-6-carboxylate (PubChem CID 17127835) has the molecular formula C23H20N2O4S and a molecular weight of 420.49 g/mol. Its IUPAC name is butyl 2-[(5-phenylfuran-2-carbonyl)amino]-1,3-benzothiazole-6-carboxylate.
| Compound Name | butyl 2-[(5-phenylfuran-2-carbonyl)amino]-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 17127835 |
| Molecular Formula | C23H20N2O4S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | butyl 2-[(5-phenylfuran-2-carbonyl)amino]-1,3-benzothiazole-6-carboxylate |
| SMILES | CCCCOC(=O)c1ccc2nc(NC(=O)c3ccc(-c4ccccc4)o3)sc2c1 |
| InChI | InChI=1S/C23H20N2O4S/c1-2-3-13-28-22(27)16-9-10-17-20(14-16)30-23(24-17)25-21(26)19-12-11-18(29-19)15-7-5-4-6-8-15/h4-12,14H,2-3,13H2,1H3,(H,24,25,26) |
| InChIKey | GFRUULRCXNOMQJ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|