C20H21N3O4S — CID 3160184
N-[2-(butanoylamino)-1,3-benzothiazol-6-yl]-3,5-dimethoxybenzamide (PubChem CID 3160184) has the molecular formula C20H21N3O4S and a molecular weight of 399.47 g/mol. Its IUPAC name is N-[2-(butanoylamino)-1,3-benzothiazol-6-yl]-3,5-dimethoxybenzamide.
| Compound Name | N-[2-(butanoylamino)-1,3-benzothiazol-6-yl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 3160184 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | N-[2-(butanoylamino)-1,3-benzothiazol-6-yl]-3,5-dimethoxybenzamide |
| SMILES | CCCC(=O)Nc1nc2ccc(NC(=O)c3cc(OC)cc(OC)c3)cc2s1 |
| InChI | InChI=1S/C20H21N3O4S/c1-4-5-18(24)23-20-22-16-7-6-13(10-17(16)28-20)21-19(25)12-8-14(26-2)11-15(9-12)27-3/h6-11H,4-5H2,1-3H3,(H,21,25)(H,22,23,24) |
| InChIKey | FZJHJFUSFKULIE-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |