C16H9Cl2N5OS — CID 4679677
2,5-dichloro-N-[4-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]benzamide (PubChem CID 4679677) has the molecular formula C16H9Cl2N5OS and a molecular weight of 390.26 g/mol. Its IUPAC name is 2,5-dichloro-N-[4-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]benzamide.
| Compound Name | 2,5-dichloro-N-[4-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 4679677 |
| Molecular Formula | C16H9Cl2N5OS |
| Molecular Weight | 390.26 g/mol |
| Exact Mass | 388.99 |
| IUPAC Name | 2,5-dichloro-N-[4-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(-c2nn3cnnc3s2)cc1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H9Cl2N5OS/c17-10-3-6-13(18)12(7-10)14(24)20-11-4-1-9(2-5-11)15-22-23-8-19-21-16(23)25-15/h1-8H,(H,20,24) |
| InChIKey | VNMHWOIMJRRVEJ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.26 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |