C10H7N5OS — CID 168652646
N-[4-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]formamide (PubChem CID 168652646) has the molecular formula C10H7N5OS and a molecular weight of 245.27 g/mol. Its IUPAC name is N-[4-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]formamide.
| Compound Name | N-[4-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]formamide |
|---|---|
| PubChem CID | 168652646 |
| Molecular Formula | C10H7N5OS |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | N-[4-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]formamide |
| SMILES | O=CNc1ccc(-c2nn3cnnc3s2)cc1 |
| InChI | InChI=1S/C10H7N5OS/c16-6-11-8-3-1-7(2-4-8)9-14-15-5-12-13-10(15)17-9/h1-6H,(H,11,16) |
| InChIKey | OOSYXLWFKFVPTJ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|