C12H9N9S — CID 172978813
(1Z)-2-amino-2-imino-N-[4-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)anilino]ethanimidoyl cyanide (PubChem CID 172978813) has the molecular formula C12H9N9S and a molecular weight of 311.33 g/mol. Its IUPAC name is (1Z)-2-amino-2-imino-N-[4-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)anilino]ethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-2-imino-N-[4-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)anilino]ethanimidoyl cyanide |
|---|---|
| PubChem CID | 172978813 |
| Molecular Formula | C12H9N9S |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | (1Z)-2-amino-2-imino-N-[4-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)anilino]ethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1ccc(-c2nn3cnnc3s2)cc1 |
| InChI | InChI=1S/C12H9N9S/c13-5-9(10(14)15)18-17-8-3-1-7(2-4-8)11-20-21-6-16-19-12(21)22-11/h1-4,6,17H,(H3,14,15)/b18-9+ |
| InChIKey | LPQJGDXZIMKWSZ-GIJQJNRQSA-N |
| XLogP | 1.08 |
| TPSA | 141.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|