C14H13N9S — CID 172978212
(1Z)-2-amino-2-imino-N-[2-methyl-5-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)anilino]ethanimidoyl cyanide (PubChem CID 172978212) has the molecular formula C14H13N9S and a molecular weight of 339.39 g/mol. Its IUPAC name is (1Z)-2-amino-2-imino-N-[2-methyl-5-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)anilino]ethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-2-imino-N-[2-methyl-5-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)anilino]ethanimidoyl cyanide |
|---|---|
| PubChem CID | 172978212 |
| Molecular Formula | C14H13N9S |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | (1Z)-2-amino-2-imino-N-[2-methyl-5-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)anilino]ethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1cc(-c2nn3c(C)nnc3s2)ccc1C |
| InChI | InChI=1S/C14H13N9S/c1-7-3-4-9(5-10(7)19-20-11(6-15)12(16)17)13-22-23-8(2)18-21-14(23)24-13/h3-5,19H,1-2H3,(H3,16,17)/b20-11+ |
| InChIKey | YAAFUDFBYNNWCW-RGVLZGJSSA-N |
| XLogP | 1.70 |
| TPSA | 141.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|