C16H6F5N5OS — CID 17219634
2,3,4,5,6-pentafluoro-N-[4-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]benzamide (PubChem CID 17219634) has the molecular formula C16H6F5N5OS and a molecular weight of 411.32 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[4-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[4-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 17219634 |
| Molecular Formula | C16H6F5N5OS |
| Molecular Weight | 411.32 g/mol |
| Exact Mass | 411.02 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[4-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(-c2nn3cnnc3s2)cc1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C16H6F5N5OS/c17-9-8(10(18)12(20)13(21)11(9)19)14(27)23-7-3-1-6(2-4-7)15-25-26-5-22-24-16(26)28-15/h1-5H,(H,23,27) |
| InChIKey | RTAZRXPWJVSWMD-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.32 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|