C17H11ClN6O3S — CID 3447996
2-chloro-N-[4-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]-5-nitrobenzamide (PubChem CID 3447996) has the molecular formula C17H11ClN6O3S and a molecular weight of 414.83 g/mol. Its IUPAC name is 2-chloro-N-[4-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]-5-nitrobenzamide.
| Compound Name | 2-chloro-N-[4-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 3447996 |
| Molecular Formula | C17H11ClN6O3S |
| Molecular Weight | 414.83 g/mol |
| Exact Mass | 414.03 |
| IUPAC Name | 2-chloro-N-[4-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]-5-nitrobenzamide |
| SMILES | Cc1nnc2sc(-c3ccc(NC(=O)c4cc([N+](=O)[O-])ccc4Cl)cc3)nn12 |
| InChI | InChI=1S/C17H11ClN6O3S/c1-9-20-21-17-23(9)22-16(28-17)10-2-4-11(5-3-10)19-15(25)13-8-12(24(26)27)6-7-14(13)18/h2-8H,1H3,(H,19,25) |
| InChIKey | NYQFCBJTTMZBMQ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.83 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|