C10H5Cl2N5OS — CID 110384752
N-(3,4-dichlorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole-6-carboxamide (PubChem CID 110384752) has the molecular formula C10H5Cl2N5OS and a molecular weight of 314.16 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole-6-carboxamide.
| Compound Name | N-(3,4-dichlorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole-6-carboxamide |
|---|---|
| PubChem CID | 110384752 |
| Molecular Formula | C10H5Cl2N5OS |
| Molecular Weight | 314.16 g/mol |
| Exact Mass | 312.96 |
| IUPAC Name | N-(3,4-dichlorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole-6-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)c1nn2cnnc2s1 |
| InChI | InChI=1S/C10H5Cl2N5OS/c11-6-2-1-5(3-7(6)12)14-8(18)9-16-17-4-13-15-10(17)19-9/h1-4H,(H,14,18) |
| InChIKey | ILJZFVALORMYHF-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.16 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |