C17H10Cl2N6OS2 — CID 3639024
3,4-dichloro-N-[[3-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]benzamide (PubChem CID 3639024) has the molecular formula C17H10Cl2N6OS2 and a molecular weight of 449.35 g/mol. Its IUPAC name is 3,4-dichloro-N-[[3-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]benzamide.
| Compound Name | 3,4-dichloro-N-[[3-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 3639024 |
| Molecular Formula | C17H10Cl2N6OS2 |
| Molecular Weight | 449.35 g/mol |
| Exact Mass | 447.97 |
| IUPAC Name | 3,4-dichloro-N-[[3-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1cccc(-c2nn3cnnc3s2)c1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H10Cl2N6OS2/c18-12-5-4-9(7-13(12)19)14(26)22-16(27)21-11-3-1-2-10(6-11)15-24-25-8-20-23-17(25)28-15/h1-8H,(H2,21,22,26,27) |
| InChIKey | ZVVZHKYROVMGNU-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 84.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.35 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|