C21H21N5OS — CID 3812987
N-[5-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methylphenyl]-3,4-dimethylbenzamide (PubChem CID 3812987) has the molecular formula C21H21N5OS and a molecular weight of 391.50 g/mol. Its IUPAC name is N-[5-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methylphenyl]-3,4-dimethylbenzamide.
| Compound Name | N-[5-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methylphenyl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 3812987 |
| Molecular Formula | C21H21N5OS |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | N-[5-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methylphenyl]-3,4-dimethylbenzamide |
| SMILES | CCc1nnc2sc(-c3ccc(C)c(NC(=O)c4ccc(C)c(C)c4)c3)nn12 |
| InChI | InChI=1S/C21H21N5OS/c1-5-18-23-24-21-26(18)25-20(28-21)16-9-7-13(3)17(11-16)22-19(27)15-8-6-12(2)14(4)10-15/h6-11H,5H2,1-4H3,(H,22,27) |
| InChIKey | DYFNMISQCLGDIA-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |