C20H21N3OS — CID 11983488
2-[4-(thian-4-ylmethyl)phenyl]-3H-benzimidazole-5-carboxamide (PubChem CID 11983488) has the molecular formula C20H21N3OS and a molecular weight of 351.48 g/mol. Its IUPAC name is 2-[4-(thian-4-ylmethyl)phenyl]-3H-benzimidazole-5-carboxamide.
| Compound Name | 2-[4-(thian-4-ylmethyl)phenyl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 11983488 |
| Molecular Formula | C20H21N3OS |
| Molecular Weight | 351.48 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 2-[4-(thian-4-ylmethyl)phenyl]-3H-benzimidazole-5-carboxamide |
| SMILES | NC(=O)c1ccc2nc(-c3ccc(CC4CCSCC4)cc3)[nH]c2c1 |
| InChI | InChI=1S/C20H21N3OS/c21-19(24)16-5-6-17-18(12-16)23-20(22-17)15-3-1-13(2-4-15)11-14-7-9-25-10-8-14/h1-6,12,14H,7-11H2,(H2,21,24)(H,22,23) |
| InChIKey | PWKJUBUSQKPMPU-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.48 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |