C26H25ClN4O2 — CID 11705277
2-[4-[1-[(4-chlorophenyl)methyl]piperidin-3-yl]oxyphenyl]-3H-benzimidazole-5-carboxamide (PubChem CID 11705277) has the molecular formula C26H25ClN4O2 and a molecular weight of 460.97 g/mol. Its IUPAC name is 2-[4-[1-[(4-chlorophenyl)methyl]piperidin-3-yl]oxyphenyl]-3H-benzimidazole-5-carboxamide.
| Compound Name | 2-[4-[1-[(4-chlorophenyl)methyl]piperidin-3-yl]oxyphenyl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 11705277 |
| Molecular Formula | C26H25ClN4O2 |
| Molecular Weight | 460.97 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 2-[4-[1-[(4-chlorophenyl)methyl]piperidin-3-yl]oxyphenyl]-3H-benzimidazole-5-carboxamide |
| SMILES | NC(=O)c1ccc2nc(-c3ccc(OC4CCCN(Cc5ccc(Cl)cc5)C4)cc3)[nH]c2c1 |
| InChI | InChI=1S/C26H25ClN4O2/c27-20-8-3-17(4-9-20)15-31-13-1-2-22(16-31)33-21-10-5-18(6-11-21)26-29-23-12-7-19(25(28)32)14-24(23)30-26/h3-12,14,22H,1-2,13,15-16H2,(H2,28,32)(H,29,30) |
| InChIKey | ATXZSOWKMJBHBF-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.97 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |