C19H20ClN3O — CID 141198459
[(2R)-1-[[4-(6-chloro-1H-benzimidazol-2-yl)phenyl]methyl]pyrrolidin-2-yl]methanol (PubChem CID 141198459) has the molecular formula C19H20ClN3O and a molecular weight of 341.84 g/mol. Its IUPAC name is [(2R)-1-[[4-(6-chloro-1H-benzimidazol-2-yl)phenyl]methyl]pyrrolidin-2-yl]methanol.
| Compound Name | [(2R)-1-[[4-(6-chloro-1H-benzimidazol-2-yl)phenyl]methyl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 141198459 |
| Molecular Formula | C19H20ClN3O |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | [(2R)-1-[[4-(6-chloro-1H-benzimidazol-2-yl)phenyl]methyl]pyrrolidin-2-yl]methanol |
| SMILES | OC[C@H]1CCCN1Cc1ccc(-c2nc3ccc(Cl)cc3[nH]2)cc1 |
| InChI | InChI=1S/C19H20ClN3O/c20-15-7-8-17-18(10-15)22-19(21-17)14-5-3-13(4-6-14)11-23-9-1-2-16(23)12-24/h3-8,10,16,24H,1-2,9,11-12H2,(H,21,22)/t16-/m1/s1 |
| InChIKey | XXXWHTHDWITMLM-MRXNPFEDSA-N |
| XLogP | 3.84 |
| TPSA | 52.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |