C21H16ClN3O2 — CID 11394800
2-[4-[(4-chlorophenyl)-hydroxymethyl]phenyl]-3H-benzimidazole-5-carboxamide (PubChem CID 11394800) has the molecular formula C21H16ClN3O2 and a molecular weight of 377.83 g/mol. Its IUPAC name is 2-[4-[(4-chlorophenyl)-hydroxymethyl]phenyl]-3H-benzimidazole-5-carboxamide.
| Compound Name | 2-[4-[(4-chlorophenyl)-hydroxymethyl]phenyl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 11394800 |
| Molecular Formula | C21H16ClN3O2 |
| Molecular Weight | 377.83 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 2-[4-[(4-chlorophenyl)-hydroxymethyl]phenyl]-3H-benzimidazole-5-carboxamide |
| SMILES | NC(=O)c1ccc2nc(-c3ccc(C(O)c4ccc(Cl)cc4)cc3)[nH]c2c1 |
| InChI | InChI=1S/C21H16ClN3O2/c22-16-8-5-13(6-9-16)19(26)12-1-3-14(4-2-12)21-24-17-10-7-15(20(23)27)11-18(17)25-21/h1-11,19,26H,(H2,23,27)(H,24,25) |
| InChIKey | ZJHFPGDWRJEXNI-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.83 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |