C25H19N3O3 — CID 69346240
[2-[4-[hydroxy(naphthalen-2-yl)methyl]phenyl]-3H-benzimidazol-5-yl] carbamate (PubChem CID 69346240) has the molecular formula C25H19N3O3 and a molecular weight of 409.45 g/mol. Its IUPAC name is [2-[4-[hydroxy(naphthalen-2-yl)methyl]phenyl]-3H-benzimidazol-5-yl] carbamate.
| Compound Name | [2-[4-[hydroxy(naphthalen-2-yl)methyl]phenyl]-3H-benzimidazol-5-yl] carbamate |
|---|---|
| PubChem CID | 69346240 |
| Molecular Formula | C25H19N3O3 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | [2-[4-[hydroxy(naphthalen-2-yl)methyl]phenyl]-3H-benzimidazol-5-yl] carbamate |
| SMILES | NC(=O)Oc1ccc2nc(-c3ccc(C(O)c4ccc5ccccc5c4)cc3)[nH]c2c1 |
| InChI | InChI=1S/C25H19N3O3/c26-25(30)31-20-11-12-21-22(14-20)28-24(27-21)17-8-6-16(7-9-17)23(29)19-10-5-15-3-1-2-4-18(15)13-19/h1-14,23,29H,(H2,26,30)(H,27,28) |
| InChIKey | GYMDSSDRAAOKBI-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |