C19H17N5O3 — CID 69342788
[2-[4-[hydroxy-(1-methylimidazol-2-yl)methyl]phenyl]-3H-benzimidazol-5-yl] carbamate (PubChem CID 69342788) has the molecular formula C19H17N5O3 and a molecular weight of 363.38 g/mol. Its IUPAC name is [2-[4-[hydroxy-(1-methylimidazol-2-yl)methyl]phenyl]-3H-benzimidazol-5-yl] carbamate.
| Compound Name | [2-[4-[hydroxy-(1-methylimidazol-2-yl)methyl]phenyl]-3H-benzimidazol-5-yl] carbamate |
|---|---|
| PubChem CID | 69342788 |
| Molecular Formula | C19H17N5O3 |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | [2-[4-[hydroxy-(1-methylimidazol-2-yl)methyl]phenyl]-3H-benzimidazol-5-yl] carbamate |
| SMILES | Cn1ccnc1C(O)c1ccc(-c2nc3ccc(OC(N)=O)cc3[nH]2)cc1 |
| InChI | InChI=1S/C19H17N5O3/c1-24-9-8-21-18(24)16(25)11-2-4-12(5-3-11)17-22-14-7-6-13(27-19(20)26)10-15(14)23-17/h2-10,16,25H,1H3,(H2,20,26)(H,22,23) |
| InChIKey | WIIDRYNPWQBAPY-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |