C22H19N3O3 — CID 69371809
[2-[4-(4-ethylphenoxy)phenyl]-3H-benzimidazol-5-yl] carbamate (PubChem CID 69371809) has the molecular formula C22H19N3O3 and a molecular weight of 373.41 g/mol. Its IUPAC name is [2-[4-(4-ethylphenoxy)phenyl]-3H-benzimidazol-5-yl] carbamate.
| Compound Name | [2-[4-(4-ethylphenoxy)phenyl]-3H-benzimidazol-5-yl] carbamate |
|---|---|
| PubChem CID | 69371809 |
| Molecular Formula | C22H19N3O3 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | [2-[4-(4-ethylphenoxy)phenyl]-3H-benzimidazol-5-yl] carbamate |
| SMILES | CCc1ccc(Oc2ccc(-c3nc4ccc(OC(N)=O)cc4[nH]3)cc2)cc1 |
| InChI | InChI=1S/C22H19N3O3/c1-2-14-3-7-16(8-4-14)27-17-9-5-15(6-10-17)21-24-19-12-11-18(28-22(23)26)13-20(19)25-21/h3-13H,2H2,1H3,(H2,23,26)(H,24,25) |
| InChIKey | SJGZJEBBNGLBCX-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |