C19H14N4O2 — CID 69373002
[2-(4-pyridin-2-ylphenyl)-3H-benzimidazol-5-yl] carbamate (PubChem CID 69373002) has the molecular formula C19H14N4O2 and a molecular weight of 330.35 g/mol. Its IUPAC name is [2-(4-pyridin-2-ylphenyl)-3H-benzimidazol-5-yl] carbamate.
| Compound Name | [2-(4-pyridin-2-ylphenyl)-3H-benzimidazol-5-yl] carbamate |
|---|---|
| PubChem CID | 69373002 |
| Molecular Formula | C19H14N4O2 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | [2-(4-pyridin-2-ylphenyl)-3H-benzimidazol-5-yl] carbamate |
| SMILES | NC(=O)Oc1ccc2nc(-c3ccc(-c4ccccn4)cc3)[nH]c2c1 |
| InChI | InChI=1S/C19H14N4O2/c20-19(24)25-14-8-9-16-17(11-14)23-18(22-16)13-6-4-12(5-7-13)15-3-1-2-10-21-15/h1-11H,(H2,20,24)(H,22,23) |
| InChIKey | SVTWKHBTJUTDPD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |