C19H15N3O4 — CID 69343119
[2-[4-[furan-3-yl(hydroxy)methyl]phenyl]-3H-benzimidazol-5-yl] carbamate (PubChem CID 69343119) has the molecular formula C19H15N3O4 and a molecular weight of 349.35 g/mol. Its IUPAC name is [2-[4-[furan-3-yl(hydroxy)methyl]phenyl]-3H-benzimidazol-5-yl] carbamate.
| Compound Name | [2-[4-[furan-3-yl(hydroxy)methyl]phenyl]-3H-benzimidazol-5-yl] carbamate |
|---|---|
| PubChem CID | 69343119 |
| Molecular Formula | C19H15N3O4 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | [2-[4-[furan-3-yl(hydroxy)methyl]phenyl]-3H-benzimidazol-5-yl] carbamate |
| SMILES | NC(=O)Oc1ccc2nc(-c3ccc(C(O)c4ccoc4)cc3)[nH]c2c1 |
| InChI | InChI=1S/C19H15N3O4/c20-19(24)26-14-5-6-15-16(9-14)22-18(21-15)12-3-1-11(2-4-12)17(23)13-7-8-25-10-13/h1-10,17,23H,(H2,20,24)(H,21,22) |
| InChIKey | UHRAZOBLCGTQRD-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 114.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |