C21H18N4O5S — CID 69371270
[2-[4-[4-(methanesulfonamido)phenoxy]phenyl]-3H-benzimidazol-5-yl] carbamate (PubChem CID 69371270) has the molecular formula C21H18N4O5S and a molecular weight of 438.47 g/mol. Its IUPAC name is [2-[4-[4-(methanesulfonamido)phenoxy]phenyl]-3H-benzimidazol-5-yl] carbamate.
| Compound Name | [2-[4-[4-(methanesulfonamido)phenoxy]phenyl]-3H-benzimidazol-5-yl] carbamate |
|---|---|
| PubChem CID | 69371270 |
| Molecular Formula | C21H18N4O5S |
| Molecular Weight | 438.47 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | [2-[4-[4-(methanesulfonamido)phenoxy]phenyl]-3H-benzimidazol-5-yl] carbamate |
| SMILES | CS(=O)(=O)Nc1ccc(Oc2ccc(-c3nc4ccc(OC(N)=O)cc4[nH]3)cc2)cc1 |
| InChI | InChI=1S/C21H18N4O5S/c1-31(27,28)25-14-4-8-16(9-5-14)29-15-6-2-13(3-7-15)20-23-18-11-10-17(30-21(22)26)12-19(18)24-20/h2-12,25H,1H3,(H2,22,26)(H,23,24) |
| InChIKey | MAWNIJKGMJHWEU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.47 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |