C22H24N4O4 — CID 67073190
[2-[4-[(1-acetylpiperidin-3-yl)methoxy]phenyl]-3H-benzimidazol-5-yl] carbamate (PubChem CID 67073190) has the molecular formula C22H24N4O4 and a molecular weight of 408.46 g/mol. Its IUPAC name is [2-[4-[(1-acetylpiperidin-3-yl)methoxy]phenyl]-3H-benzimidazol-5-yl] carbamate.
| Compound Name | [2-[4-[(1-acetylpiperidin-3-yl)methoxy]phenyl]-3H-benzimidazol-5-yl] carbamate |
|---|---|
| PubChem CID | 67073190 |
| Molecular Formula | C22H24N4O4 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | [2-[4-[(1-acetylpiperidin-3-yl)methoxy]phenyl]-3H-benzimidazol-5-yl] carbamate |
| SMILES | CC(=O)N1CCCC(COc2ccc(-c3nc4ccc(OC(N)=O)cc4[nH]3)cc2)C1 |
| InChI | InChI=1S/C22H24N4O4/c1-14(27)26-10-2-3-15(12-26)13-29-17-6-4-16(5-7-17)21-24-19-9-8-18(30-22(23)28)11-20(19)25-21/h4-9,11,15H,2-3,10,12-13H2,1H3,(H2,23,28)(H,24,25) |
| InChIKey | CZDAHPXFGIKCOT-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 110.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |