C20H14Cl2N4O3S — CID 10115542
2-[4-[(3,4-dichlorophenyl)sulfamoyl]phenyl]-3H-benzimidazole-5-carboxamide (PubChem CID 10115542) has the molecular formula C20H14Cl2N4O3S and a molecular weight of 461.33 g/mol. Its IUPAC name is 2-[4-[(3,4-dichlorophenyl)sulfamoyl]phenyl]-3H-benzimidazole-5-carboxamide.
| Compound Name | 2-[4-[(3,4-dichlorophenyl)sulfamoyl]phenyl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 10115542 |
| Molecular Formula | C20H14Cl2N4O3S |
| Molecular Weight | 461.33 g/mol |
| Exact Mass | 460.02 |
| IUPAC Name | 2-[4-[(3,4-dichlorophenyl)sulfamoyl]phenyl]-3H-benzimidazole-5-carboxamide |
| SMILES | NC(=O)c1ccc2nc(-c3ccc(S(=O)(=O)Nc4ccc(Cl)c(Cl)c4)cc3)[nH]c2c1 |
| InChI | InChI=1S/C20H14Cl2N4O3S/c21-15-7-4-13(10-16(15)22)26-30(28,29)14-5-1-11(2-6-14)20-24-17-8-3-12(19(23)27)9-18(17)25-20/h1-10,26H,(H2,23,27)(H,24,25) |
| InChIKey | DZICGNYWCKQHLC-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.33 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |