C22H20N4O4S — CID 146021640
2-methoxy-5-[[4-(6-methyl-1H-benzimidazol-2-yl)phenyl]sulfamoyl]benzamide (PubChem CID 146021640) has the molecular formula C22H20N4O4S and a molecular weight of 436.49 g/mol. Its IUPAC name is 2-methoxy-5-[[4-(6-methyl-1H-benzimidazol-2-yl)phenyl]sulfamoyl]benzamide.
| Compound Name | 2-methoxy-5-[[4-(6-methyl-1H-benzimidazol-2-yl)phenyl]sulfamoyl]benzamide |
|---|---|
| PubChem CID | 146021640 |
| Molecular Formula | C22H20N4O4S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 2-methoxy-5-[[4-(6-methyl-1H-benzimidazol-2-yl)phenyl]sulfamoyl]benzamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(-c3nc4ccc(C)cc4[nH]3)cc2)cc1C(N)=O |
| InChI | InChI=1S/C22H20N4O4S/c1-13-3-9-18-19(11-13)25-22(24-18)14-4-6-15(7-5-14)26-31(28,29)16-8-10-20(30-2)17(12-16)21(23)27/h3-12,26H,1-2H3,(H2,23,27)(H,24,25) |
| InChIKey | KZLXMSFSUUDQNP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |