C14H15N3O4S — CID 146024539
2-methoxy-5-[(6-methyl-2-pyridinyl)sulfamoyl]benzamide (PubChem CID 146024539) has the molecular formula C14H15N3O4S and a molecular weight of 321.36 g/mol. Its IUPAC name is 2-methoxy-5-[(6-methyl-2-pyridinyl)sulfamoyl]benzamide.
| Compound Name | 2-methoxy-5-[(6-methyl-2-pyridinyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 146024539 |
| Molecular Formula | C14H15N3O4S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 2-methoxy-5-[(6-methyl-2-pyridinyl)sulfamoyl]benzamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2cccc(C)n2)cc1C(N)=O |
| InChI | InChI=1S/C14H15N3O4S/c1-9-4-3-5-13(16-9)17-22(19,20)10-6-7-12(21-2)11(8-10)14(15)18/h3-8H,1-2H3,(H2,15,18)(H,16,17) |
| InChIKey | LQTQTOVCCDAVEQ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |