C14H17N5O4S — CID 122298121
5-[[2-(dimethylamino)pyrimidin-5-yl]sulfamoyl]-2-methoxybenzamide (PubChem CID 122298121) has the molecular formula C14H17N5O4S and a molecular weight of 351.39 g/mol. Its IUPAC name is 5-[[2-(dimethylamino)pyrimidin-5-yl]sulfamoyl]-2-methoxybenzamide.
| Compound Name | 5-[[2-(dimethylamino)pyrimidin-5-yl]sulfamoyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 122298121 |
| Molecular Formula | C14H17N5O4S |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 5-[[2-(dimethylamino)pyrimidin-5-yl]sulfamoyl]-2-methoxybenzamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2cnc(N(C)C)nc2)cc1C(N)=O |
| InChI | InChI=1S/C14H17N5O4S/c1-19(2)14-16-7-9(8-17-14)18-24(21,22)10-4-5-12(23-3)11(6-10)13(15)20/h4-8,18H,1-3H3,(H2,15,20) |
| InChIKey | FFDHITQXOIGZSP-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 127.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |