C24H23NO3 — CID 46637989
N-(2,2-diphenylpropyl)-2,3-dihydro-1,4-benzodioxine-6-carboxamide (PubChem CID 46637989) has the molecular formula C24H23NO3 and a molecular weight of 373.45 g/mol. Its IUPAC name is N-(2,2-diphenylpropyl)-2,3-dihydro-1,4-benzodioxine-6-carboxamide.
| Compound Name | N-(2,2-diphenylpropyl)-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
|---|---|
| PubChem CID | 46637989 |
| Molecular Formula | C24H23NO3 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | N-(2,2-diphenylpropyl)-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
| SMILES | CC(CNC(=O)c1ccc2c(c1)OCCO2)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H23NO3/c1-24(19-8-4-2-5-9-19,20-10-6-3-7-11-20)17-25-23(26)18-12-13-21-22(16-18)28-15-14-27-21/h2-13,16H,14-15,17H2,1H3,(H,25,26) |
| InChIKey | JNUAALURISORCH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |