C21H27N5O — CID 124829821
1-[[4-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]-3-[(1R,2R,6S,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]urea (PubChem CID 124829821) has the molecular formula C21H27N5O and a molecular weight of 365.48 g/mol. Its IUPAC name is 1-[[4-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]-3-[(1R,2R,6S,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]urea.
| Compound Name | 1-[[4-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]-3-[(1R,2R,6S,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]urea |
|---|---|
| PubChem CID | 124829821 |
| Molecular Formula | C21H27N5O |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | 1-[[4-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]-3-[(1R,2R,6S,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]urea |
| SMILES | O=C(NCc1ccc(Cn2cncn2)cc1)N[C@@H]1C[C@H]2C[C@H]1[C@H]1CCC[C@H]21 |
| InChI | InChI=1S/C21H27N5O/c27-21(25-20-9-16-8-19(20)18-3-1-2-17(16)18)23-10-14-4-6-15(7-5-14)11-26-13-22-12-24-26/h4-7,12-13,16-20H,1-3,8-11H2,(H2,23,25,27)/t16-,17-,18+,19+,20-/m1/s1 |
| InChIKey | QPBXCKHVUSMLJE-SWBPCFCJSA-N |
| XLogP | 2.95 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |