C19H25NO3S — CID 43066743
3-(methylsulfonylmethyl)-N-(8-tricyclo[5.2.1.02,6]decanyl)benzamide (PubChem CID 43066743) has the molecular formula C19H25NO3S and a molecular weight of 347.48 g/mol. Its IUPAC name is 3-(methylsulfonylmethyl)-N-(8-tricyclo[5.2.1.02,6]decanyl)benzamide.
| Compound Name | 3-(methylsulfonylmethyl)-N-(8-tricyclo[5.2.1.02,6]decanyl)benzamide |
|---|---|
| PubChem CID | 43066743 |
| Molecular Formula | C19H25NO3S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 3-(methylsulfonylmethyl)-N-(8-tricyclo[5.2.1.02,6]decanyl)benzamide |
| SMILES | CS(=O)(=O)Cc1cccc(C(=O)NC2CC3CC2C2CCCC32)c1 |
| InChI | InChI=1S/C19H25NO3S/c1-24(22,23)11-12-4-2-5-13(8-12)19(21)20-18-10-14-9-17(18)16-7-3-6-15(14)16/h2,4-5,8,14-18H,3,6-7,9-11H2,1H3,(H,20,21) |
| InChIKey | PBLJAHGHMGXKFZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |