C17H24N2O2 — CID 6598954
3-acetamido-N-[(1S,2R,3S)-2,3-dimethylcyclohexyl]benzamide (PubChem CID 6598954) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 3-acetamido-N-[(1S,2R,3S)-2,3-dimethylcyclohexyl]benzamide.
| Compound Name | 3-acetamido-N-[(1S,2R,3S)-2,3-dimethylcyclohexyl]benzamide |
|---|---|
| PubChem CID | 6598954 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 3-acetamido-N-[(1S,2R,3S)-2,3-dimethylcyclohexyl]benzamide |
| SMILES | CC(=O)Nc1cccc(C(=O)N[C@H]2CCC[C@H](C)[C@H]2C)c1 |
| InChI | InChI=1S/C17H24N2O2/c1-11-6-4-9-16(12(11)2)19-17(21)14-7-5-8-15(10-14)18-13(3)20/h5,7-8,10-12,16H,4,6,9H2,1-3H3,(H,18,20)(H,19,21)/t11-,12+,16-/m0/s1 |
| InChIKey | IPQNIZANYSVYOO-OZVIIMIRSA-N |
| XLogP | 3.20 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |