C15H21ClN2O — CID 4064098
1-(3-chlorophenyl)-3-(2,3-dimethylcyclohexyl)urea (PubChem CID 4064098) has the molecular formula C15H21ClN2O and a molecular weight of 280.80 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-(2,3-dimethylcyclohexyl)urea.
| Compound Name | 1-(3-chlorophenyl)-3-(2,3-dimethylcyclohexyl)urea |
|---|---|
| PubChem CID | 4064098 |
| Molecular Formula | C15H21ClN2O |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 1-(3-chlorophenyl)-3-(2,3-dimethylcyclohexyl)urea |
| SMILES | CC1CCCC(NC(=O)Nc2cccc(Cl)c2)C1C |
| InChI | InChI=1S/C15H21ClN2O/c1-10-5-3-8-14(11(10)2)18-15(19)17-13-7-4-6-12(16)9-13/h4,6-7,9-11,14H,3,5,8H2,1-2H3,(H2,17,18,19) |
| InChIKey | VHKKREFCQLNRKR-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |