C18H24N2O3S — CID 138050387
2-[(4-cyanophenyl)methylsulfonyl]-N-(2-methylcyclohexyl)propanamide (PubChem CID 138050387) has the molecular formula C18H24N2O3S and a molecular weight of 348.47 g/mol. Its IUPAC name is 2-[(4-cyanophenyl)methylsulfonyl]-N-(2-methylcyclohexyl)propanamide.
| Compound Name | 2-[(4-cyanophenyl)methylsulfonyl]-N-(2-methylcyclohexyl)propanamide |
|---|---|
| PubChem CID | 138050387 |
| Molecular Formula | C18H24N2O3S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 2-[(4-cyanophenyl)methylsulfonyl]-N-(2-methylcyclohexyl)propanamide |
| SMILES | CC1CCCCC1NC(=O)C(C)S(=O)(=O)Cc1ccc(C#N)cc1 |
| InChI | InChI=1S/C18H24N2O3S/c1-13-5-3-4-6-17(13)20-18(21)14(2)24(22,23)12-16-9-7-15(11-19)8-10-16/h7-10,13-14,17H,3-6,12H2,1-2H3,(H,20,21) |
| InChIKey | OMHRZYLLQVECNM-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |