C21H29N3O3S — CID 78876876
2-[(1-benzylimidazol-2-yl)methylsulfonyl]-N-(2-methylcyclohexyl)propanamide (PubChem CID 78876876) has the molecular formula C21H29N3O3S and a molecular weight of 403.55 g/mol. Its IUPAC name is 2-[(1-benzylimidazol-2-yl)methylsulfonyl]-N-(2-methylcyclohexyl)propanamide.
| Compound Name | 2-[(1-benzylimidazol-2-yl)methylsulfonyl]-N-(2-methylcyclohexyl)propanamide |
|---|---|
| PubChem CID | 78876876 |
| Molecular Formula | C21H29N3O3S |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 2-[(1-benzylimidazol-2-yl)methylsulfonyl]-N-(2-methylcyclohexyl)propanamide |
| SMILES | CC1CCCCC1NC(=O)C(C)S(=O)(=O)Cc1nccn1Cc1ccccc1 |
| InChI | InChI=1S/C21H29N3O3S/c1-16-8-6-7-11-19(16)23-21(25)17(2)28(26,27)15-20-22-12-13-24(20)14-18-9-4-3-5-10-18/h3-5,9-10,12-13,16-17,19H,6-8,11,14-15H2,1-2H3,(H,23,25) |
| InChIKey | PMYIVVUFGGURQG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |