C15H21N5O2S — CID 8768843
1-[[(2S)-2-(4-cyanophenoxy)propanoyl]amino]-3-[2-(dimethylamino)ethyl]thiourea (PubChem CID 8768843) has the molecular formula C15H21N5O2S and a molecular weight of 335.43 g/mol. Its IUPAC name is 1-[[(2S)-2-(4-cyanophenoxy)propanoyl]amino]-3-[2-(dimethylamino)ethyl]thiourea.
| Compound Name | 1-[[(2S)-2-(4-cyanophenoxy)propanoyl]amino]-3-[2-(dimethylamino)ethyl]thiourea |
|---|---|
| PubChem CID | 8768843 |
| Molecular Formula | C15H21N5O2S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 1-[[(2S)-2-(4-cyanophenoxy)propanoyl]amino]-3-[2-(dimethylamino)ethyl]thiourea |
| SMILES | C[C@H](Oc1ccc(C#N)cc1)C(=O)NNC(=S)NCCN(C)C |
| InChI | InChI=1S/C15H21N5O2S/c1-11(22-13-6-4-12(10-16)5-7-13)14(21)18-19-15(23)17-8-9-20(2)3/h4-7,11H,8-9H2,1-3H3,(H,18,21)(H2,17,19,23)/t11-/m0/s1 |
| InChIKey | UEMFVUOQORIYHE-NSHDSACASA-N |
| XLogP | 0.38 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|