C19H20N4O2S2 — CID 9094304
1-[[(2S)-2-(4-cyanophenoxy)propanoyl]amino]-3-(2-phenylsulfanylethyl)thiourea (PubChem CID 9094304) has the molecular formula C19H20N4O2S2 and a molecular weight of 400.53 g/mol. Its IUPAC name is 1-[[(2S)-2-(4-cyanophenoxy)propanoyl]amino]-3-(2-phenylsulfanylethyl)thiourea.
| Compound Name | 1-[[(2S)-2-(4-cyanophenoxy)propanoyl]amino]-3-(2-phenylsulfanylethyl)thiourea |
|---|---|
| PubChem CID | 9094304 |
| Molecular Formula | C19H20N4O2S2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | 1-[[(2S)-2-(4-cyanophenoxy)propanoyl]amino]-3-(2-phenylsulfanylethyl)thiourea |
| SMILES | C[C@H](Oc1ccc(C#N)cc1)C(=O)NNC(=S)NCCSc1ccccc1 |
| InChI | InChI=1S/C19H20N4O2S2/c1-14(25-16-9-7-15(13-20)8-10-16)18(24)22-23-19(26)21-11-12-27-17-5-3-2-4-6-17/h2-10,14H,11-12H2,1H3,(H,22,24)(H2,21,23,26)/t14-/m0/s1 |
| InChIKey | FDTRVZNTGLRABN-AWEZNQCLSA-N |
| XLogP | 2.61 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|