C17H24BrN3O2S — CID 8770730
1-[[(2R)-2-(3-bromophenoxy)propanoyl]amino]-3-[(1S,2R)-2-methylcyclohexyl]thiourea (PubChem CID 8770730) has the molecular formula C17H24BrN3O2S and a molecular weight of 414.37 g/mol. Its IUPAC name is 1-[[(2R)-2-(3-bromophenoxy)propanoyl]amino]-3-[(1S,2R)-2-methylcyclohexyl]thiourea.
| Compound Name | 1-[[(2R)-2-(3-bromophenoxy)propanoyl]amino]-3-[(1S,2R)-2-methylcyclohexyl]thiourea |
|---|---|
| PubChem CID | 8770730 |
| Molecular Formula | C17H24BrN3O2S |
| Molecular Weight | 414.37 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | 1-[[(2R)-2-(3-bromophenoxy)propanoyl]amino]-3-[(1S,2R)-2-methylcyclohexyl]thiourea |
| SMILES | C[C@@H]1CCCC[C@@H]1NC(=S)NNC(=O)[C@@H](C)Oc1cccc(Br)c1 |
| InChI | InChI=1S/C17H24BrN3O2S/c1-11-6-3-4-9-15(11)19-17(24)21-20-16(22)12(2)23-14-8-5-7-13(18)10-14/h5,7-8,10-12,15H,3-4,6,9H2,1-2H3,(H,20,22)(H2,19,21,24)/t11-,12-,15+/m1/s1 |
| InChIKey | ZIFVCZXXHWYLDP-JMSVASOKSA-N |
| XLogP | 3.29 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|